About 2-methoxy-3,5,6-trimethylpyrimidin-4-one
2-methoxy-3,5,6-trimethylpyrimidin-4-one (PubChem CID 13357773) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-methoxy-3,5,6-trimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 2-methoxy-3,5,6-trimethylpyrimidin-4-one |
| PubChem CID | 13357773 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-methoxy-3,5,6-trimethylpyrimidin-4-one |
| SMILES | COc1nc(C)c(C)c(=O)n1C |
| InChI | InChI=1S/C8H12N2O2/c1-5-6(2)9-8(12-4)10(3)7(5)11/h1-4H3 |
| InChIKey | XLRXNRKADYAKPR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-3,5,6-trimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,5,6-trimethylpyrimidin-4-one?
The IUPAC name of 2-methoxy-3,5,6-trimethylpyrimidin-4-one (CID 13357773) is 2-methoxy-3,5,6-trimethylpyrimidin-4-one.
What is the SMILES notation for 2-methoxy-3,5,6-trimethylpyrimidin-4-one?
The canonical SMILES for 2-methoxy-3,5,6-trimethylpyrimidin-4-one is COc1nc(C)c(C)c(=O)n1C.
What is the InChIKey of 2-methoxy-3,5,6-trimethylpyrimidin-4-one?
The InChIKey is XLRXNRKADYAKPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-6(2)9-8(12-4)10(3)7(5)11/h1-4H3.
What are the key properties of 2-methoxy-3,5,6-trimethylpyrimidin-4-one?
2-methoxy-3,5,6-trimethylpyrimidin-4-one has a molecular weight of 168.20 g/mol, XLogP of 0.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,5,6-trimethylpyrimidin-4-one is sourced from PubChem (CID 13357773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).