C24H19N3O3 — CID 13358422
(1Z)-1-[1,2-bis(4-methylphenyl)-2-oxoethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate (PubChem CID 13358422) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is (1Z)-1-[1,2-bis(4-methylphenyl)-2-oxoethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate.
| Compound Name | (1Z)-1-[1,2-bis(4-methylphenyl)-2-oxoethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate |
|---|---|
| PubChem CID | 13358422 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (1Z)-1-[1,2-bis(4-methylphenyl)-2-oxoethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate |
| SMILES | Cc1ccc(C(=O)/C(c2ccc(C)cc2)=[N+]2\N=C([O-])N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19N3O3/c1-16-8-12-18(13-9-16)21(22(28)19-14-10-17(2)11-15-19)27-24(30)26(23(29)25-27)20-6-4-3-5-7-20/h3-15H,1-2H3 |
| InChIKey | ANESWJQFPVPKBZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|