C6H2F12O2S — CID 13358484
1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)propane (PubChem CID 13358484) has the molecular formula C6H2F12O2S and a molecular weight of 366.12 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)propane |
|---|---|
| PubChem CID | 13358484 |
| Molecular Formula | C6H2F12O2S |
| Molecular Weight | 366.12 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)propane |
| SMILES | O=S(=O)(C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F12O2S/c7-3(8,9)1(4(10,11)12)21(19,20)2(5(13,14)15)6(16,17)18/h1-2H |
| InChIKey | CUFWHDFUGSYXOW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |