C24H27B3O3 — CID 13358595
2,4,6-tris(2,6-dimethylphenyl)-1,3,5,2,4,6-trioxatriborinane (PubChem CID 13358595) has the molecular formula C24H27B3O3 and a molecular weight of 395.91 g/mol. Its IUPAC name is 2,4,6-tris(2,6-dimethylphenyl)-1,3,5,2,4,6-trioxatriborinane.
| Compound Name | 2,4,6-tris(2,6-dimethylphenyl)-1,3,5,2,4,6-trioxatriborinane |
|---|---|
| PubChem CID | 13358595 |
| Molecular Formula | C24H27B3O3 |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2,4,6-tris(2,6-dimethylphenyl)-1,3,5,2,4,6-trioxatriborinane |
| SMILES | Cc1cccc(C)c1B1OB(c2c(C)cccc2C)OB(c2c(C)cccc2C)O1 |
| InChI | InChI=1S/C24H27B3O3/c1-16-10-7-11-17(2)22(16)25-28-26(23-18(3)12-8-13-19(23)4)30-27(29-25)24-20(5)14-9-15-21(24)6/h7-15H,1-6H3 |
| InChIKey | VOWFCIPHQGGXBB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|