About 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone
1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 13359062) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| PubChem CID | 13359062 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(=CC1)C2=CC(=C(C=C2)OC)OC |
| InChI | InChI=1S/C15H19NO3/c1-11(17)16-8-6-12(7-9-16)13-4-5-14(18-2)15(10-13)19-3/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | HJDDWTFXAMBRDG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | 353 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone?
The IUPAC name of 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (CID 13359062) is 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone?
The canonical SMILES for 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone is CC(=O)N1CCC(=CC1)C2=CC(=C(C=C2)OC)OC.
What is the InChIKey of 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone?
The InChIKey is HJDDWTFXAMBRDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-11(17)16-8-6-12(7-9-16)13-4-5-14(18-2)15(10-13)19-3/h4-6,10H,7-9H2,1-3H3.
What are the key properties of 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone?
1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone has a molecular weight of 261.32 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone is sourced from PubChem (CID 13359062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).