C7H6F3N3O2 — CID 13359223
4,4,4-trifluoro-3-oxo-N-(1H-pyrazol-5-yl)butanamide (PubChem CID 13359223) has the molecular formula C7H6F3N3O2 and a molecular weight of 221.14 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-oxo-N-(1H-pyrazol-5-yl)butanamide.
| Compound Name | 4,4,4-trifluoro-3-oxo-N-(1H-pyrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 13359223 |
| Molecular Formula | C7H6F3N3O2 |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 4,4,4-trifluoro-3-oxo-N-(1H-pyrazol-5-yl)butanamide |
| SMILES | O=C(CC(=O)C(F)(F)F)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H6F3N3O2/c8-7(9,10)4(14)3-6(15)12-5-1-2-11-13-5/h1-2H,3H2,(H2,11,12,13,15) |
| InChIKey | HRIWTNOAELXVOA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|