C9H8N2 — CID 13359298
(1R,2R,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonitrile (PubChem CID 13359298) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is (1R,2R,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonitrile.
| Compound Name | (1R,2R,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 13359298 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | (1R,2R,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonitrile |
| SMILES | N#C[C@@H]1[C@H](C#N)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H8N2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-9H,3H2/t6-,7+,8+,9- |
| InChIKey | DJNPQHBMESQZIP-OJOKCITNSA-N |
| XLogP | 1.47 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|