About 4-methoxy-3,6-dimethylcyclohexene
4-methoxy-3,6-dimethylcyclohexene (PubChem CID 13359358) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-methoxy-3,6-dimethylcyclohexene.
Molecular Properties
| Compound Name | 4-methoxy-3,6-dimethylcyclohexene |
| PubChem CID | 13359358 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 4-methoxy-3,6-dimethylcyclohexene |
| SMILES | COC1CC(C)C=CC1C |
| InChI | InChI=1S/C9H16O/c1-7-4-5-8(2)9(6-7)10-3/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | NXXUTQMEERQSKH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3,6-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,6-dimethylcyclohexene?
The IUPAC name of 4-methoxy-3,6-dimethylcyclohexene (CID 13359358) is 4-methoxy-3,6-dimethylcyclohexene.
What is the SMILES notation for 4-methoxy-3,6-dimethylcyclohexene?
The canonical SMILES for 4-methoxy-3,6-dimethylcyclohexene is COC1CC(C)C=CC1C.
What is the InChIKey of 4-methoxy-3,6-dimethylcyclohexene?
The InChIKey is NXXUTQMEERQSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-7-4-5-8(2)9(6-7)10-3/h4-5,7-9H,6H2,1-3H3.
What are the key properties of 4-methoxy-3,6-dimethylcyclohexene?
4-methoxy-3,6-dimethylcyclohexene has a molecular weight of 140.23 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,6-dimethylcyclohexene is sourced from PubChem (CID 13359358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).