C14H22 — CID 13359400
1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene (PubChem CID 13359400) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene |
|---|---|
| PubChem CID | 13359400 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-propan-2-ylbenzene |
| SMILES | Cc1c(C)c(C)c(C(C)C)c(C)c1C |
| InChI | InChI=1S/C14H22/c1-8(2)14-12(6)10(4)9(3)11(5)13(14)7/h8H,1-7H3 |
| InChIKey | CCDDNWQIDHQEDN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |