C25H18Br2N4OS2 — CID 13359760
(4E)-3-benzyl-4-[(Z)-[3,4-bis(4-bromophenyl)-1,3-thiazol-2-ylidene]hydrazinylidene]-1,3-thiazolidin-2-one (PubChem CID 13359760) has the molecular formula C25H18Br2N4OS2 and a molecular weight of 614.39 g/mol. Its IUPAC name is (4E)-3-benzyl-4-[(Z)-[3,4-bis(4-bromophenyl)-1,3-thiazol-2-ylidene]hydrazinylidene]-1,3-thiazolidin-2-one.
| Compound Name | (4E)-3-benzyl-4-[(Z)-[3,4-bis(4-bromophenyl)-1,3-thiazol-2-ylidene]hydrazinylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 13359760 |
| Molecular Formula | C25H18Br2N4OS2 |
| Molecular Weight | 614.39 g/mol |
| Exact Mass | 611.93 |
| IUPAC Name | (4E)-3-benzyl-4-[(Z)-[3,4-bis(4-bromophenyl)-1,3-thiazol-2-ylidene]hydrazinylidene]-1,3-thiazolidin-2-one |
| SMILES | O=C1SC/C(=N\N=c2/scc(-c3ccc(Br)cc3)n2-c2ccc(Br)cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H18Br2N4OS2/c26-19-8-6-18(7-9-19)22-15-33-24(31(22)21-12-10-20(27)11-13-21)29-28-23-16-34-25(32)30(23)14-17-4-2-1-3-5-17/h1-13,15H,14,16H2/b28-23+,29-24- |
| InChIKey | LMJHOCRIRRDERE-ABHBNJMISA-N |
| XLogP | 7.31 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.39 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|