About 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate
3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate (PubChem CID 133600108) has the molecular formula C15H19FO5S
and a molecular weight of 330.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate.
Molecular Properties
| Compound Name | 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate |
| PubChem CID | 133600108 |
| Molecular Formula | C15H19FO5S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate |
| SMILES | CC(C(=O)OCCCS(=O)(=O)C1=CC=C(C=C1)F)OCC=C |
| InChI | InChI=1S/C15H19FO5S/c1-3-9-20-12(2)15(17)21-10-4-11-22(18,19)14-7-5-13(16)6-8-14/h3,5-8,12H,1,4,9-11H2,2H3 |
| InChIKey | HIVIDLHSGCPXNU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | 449 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate?
The IUPAC name of 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate (CID 133600108) is 3-(4-fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate.
What is the SMILES notation for 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate?
The canonical SMILES for 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate is CC(C(=O)OCCCS(=O)(=O)C1=CC=C(C=C1)F)OCC=C.
What is the InChIKey of 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate?
The InChIKey is HIVIDLHSGCPXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO5S/c1-3-9-20-12(2)15(17)21-10-4-11-22(18,19)14-7-5-13(16)6-8-14/h3,5-8,12H,1,4,9-11H2,2H3.
What are the key properties of 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate?
3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate has a molecular weight of 330.40 g/mol, XLogP of 2.40, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-Fluorophenyl)sulfonylpropyl 2-prop-2-enoxypropanoate is sourced from PubChem (CID 133600108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).