About heptyl piperidine-3-carboxylate
heptyl piperidine-3-carboxylate (PubChem CID 13360541) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is heptyl piperidine-3-carboxylate.
Molecular Properties
| Compound Name | heptyl piperidine-3-carboxylate |
| PubChem CID | 13360541 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | heptyl piperidine-3-carboxylate |
| SMILES | CCCCCCCOC(=O)C1CCCNC1 |
| InChI | InChI=1S/C13H25NO2/c1-2-3-4-5-6-10-16-13(15)12-8-7-9-14-11-12/h12,14H,2-11H2,1H3 |
| InChIKey | HELDTXYRDOURBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptyl piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl piperidine-3-carboxylate?
The IUPAC name of heptyl piperidine-3-carboxylate (CID 13360541) is heptyl piperidine-3-carboxylate.
What is the SMILES notation for heptyl piperidine-3-carboxylate?
The canonical SMILES for heptyl piperidine-3-carboxylate is CCCCCCCOC(=O)C1CCCNC1.
What is the InChIKey of heptyl piperidine-3-carboxylate?
The InChIKey is HELDTXYRDOURBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-2-3-4-5-6-10-16-13(15)12-8-7-9-14-11-12/h12,14H,2-11H2,1H3.
What are the key properties of heptyl piperidine-3-carboxylate?
heptyl piperidine-3-carboxylate has a molecular weight of 227.35 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl piperidine-3-carboxylate is sourced from PubChem (CID 13360541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).