About 2-dithiocarboxyoxyacetic acid
2-dithiocarboxyoxyacetic acid (PubChem CID 13360790) has the molecular formula C3H4O3S2
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-dithiocarboxyoxyacetic acid.
Molecular Properties
| Compound Name | 2-dithiocarboxyoxyacetic acid |
| PubChem CID | 13360790 |
| Molecular Formula | C3H4O3S2 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 151.96 |
| IUPAC Name | 2-dithiocarboxyoxyacetic acid |
| SMILES | O=C(O)COC(=S)S |
| InChI | InChI=1S/C3H4O3S2/c4-2(5)1-6-3(7)8/h1H2,(H,4,5)(H,7,8) |
| InChIKey | RBOWVQWHJZWNOP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-dithiocarboxyoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dithiocarboxyoxyacetic acid?
The IUPAC name of 2-dithiocarboxyoxyacetic acid (CID 13360790) is 2-dithiocarboxyoxyacetic acid.
What is the SMILES notation for 2-dithiocarboxyoxyacetic acid?
The canonical SMILES for 2-dithiocarboxyoxyacetic acid is O=C(O)COC(=S)S.
What is the InChIKey of 2-dithiocarboxyoxyacetic acid?
The InChIKey is RBOWVQWHJZWNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3S2/c4-2(5)1-6-3(7)8/h1H2,(H,4,5)(H,7,8).
What are the key properties of 2-dithiocarboxyoxyacetic acid?
2-dithiocarboxyoxyacetic acid has a molecular weight of 152.20 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dithiocarboxyoxyacetic acid is sourced from PubChem (CID 13360790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).