C16H14N8S2 — CID 13361098
3-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)disulfanyl]-5-phenyl-1,2,4-triazol-4-amine (PubChem CID 13361098) has the molecular formula C16H14N8S2 and a molecular weight of 382.48 g/mol. Its IUPAC name is 3-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)disulfanyl]-5-phenyl-1,2,4-triazol-4-amine.
| Compound Name | 3-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)disulfanyl]-5-phenyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 13361098 |
| Molecular Formula | C16H14N8S2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)disulfanyl]-5-phenyl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SSc2nnc(-c3ccccc3)n2N)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H14N8S2/c17-23-13(11-7-3-1-4-8-11)19-21-15(23)25-26-16-22-20-14(24(16)18)12-9-5-2-6-10-12/h1-10H,17-18H2 |
| InChIKey | WQRYNUUSKOAJNC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|