About [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate
[1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate (PubChem CID 13362214) has the molecular formula C22H19Cl2N3O2
and a molecular weight of 428.32 g/mol. Its IUPAC name is [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate |
| PubChem CID | 13362214 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate |
| SMILES | O=C(OC1CCN(c2ccc(-c3ccccc3Cl)nn2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c23-16-7-5-15(6-8-16)22(28)29-17-11-13-27(14-12-17)21-10-9-20(25-26-21)18-3-1-2-4-19(18)24/h1-10,17H,11-14H2 |
| InChIKey | OUQNMRYSBSWBLQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate?
The IUPAC name of [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate (CID 13362214) is [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate.
What is the SMILES notation for [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate?
The canonical SMILES for [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate is O=C(OC1CCN(c2ccc(-c3ccccc3Cl)nn2)CC1)c1ccc(Cl)cc1.
What is the InChIKey of [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate?
The InChIKey is OUQNMRYSBSWBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl2N3O2/c23-16-7-5-15(6-8-16)22(28)29-17-11-13-27(14-12-17)21-10-9-20(25-26-21)18-3-1-2-4-19(18)24/h1-10,17H,11-14H2.
What are the key properties of [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate?
[1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate has a molecular weight of 428.32 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-yl] 4-chlorobenzoate is sourced from PubChem (CID 13362214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).