About methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate
methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 1336265) has the molecular formula C14H12FN3O3S2
and a molecular weight of 353.40 g/mol. Its IUPAC name is methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 1336265 |
| Molecular Formula | C14H12FN3O3S2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=S)NC(=O)c2ccccc2F)nc1C |
| InChI | InChI=1S/C14H12FN3O3S2/c1-7-10(12(20)21-2)23-14(16-7)18-13(22)17-11(19)8-5-3-4-6-9(8)15/h3-6H,1-2H3,(H2,16,17,18,19,22) |
| InChIKey | FLEXWLOYXRDOGU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate (CID 1336265) is methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate is COC(=O)c1sc(NC(=S)NC(=O)c2ccccc2F)nc1C.
What is the InChIKey of methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is FLEXWLOYXRDOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O3S2/c1-7-10(12(20)21-2)23-14(16-7)18-13(22)17-11(19)8-5-3-4-6-9(8)15/h3-6H,1-2H3,(H2,16,17,18,19,22).
What are the key properties of methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate?
methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 353.40 g/mol, XLogP of 2.50, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-fluorobenzoyl)carbamothioylamino]-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 1336265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).