About (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate
(3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate (PubChem CID 13363617) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate |
| PubChem CID | 13363617 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate |
| SMILES | COc1cccc(N(C)C(=O)Oc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C16H18N2O3/c1-11-8-9-13(10-12(11)2)21-16(19)18(3)14-6-5-7-15(17-14)20-4/h5-10H,1-4H3 |
| InChIKey | XMCFDBPNVUFHLV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate?
The IUPAC name of (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate (CID 13363617) is (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate.
What is the SMILES notation for (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate?
The canonical SMILES for (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate is COc1cccc(N(C)C(=O)Oc2ccc(C)c(C)c2)n1.
What is the InChIKey of (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate?
The InChIKey is XMCFDBPNVUFHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-11-8-9-13(10-12(11)2)21-16(19)18(3)14-6-5-7-15(17-14)20-4/h5-10H,1-4H3.
What are the key properties of (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate?
(3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate has a molecular weight of 286.33 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamate is sourced from PubChem (CID 13363617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).