C25H23ClF2N2O6S — CID 13364173
benzhydryl 3-(chloromethyl)-7-[[2-(difluoromethylsulfanyl)acetyl]amino]-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 13364173) has the molecular formula C25H23ClF2N2O6S and a molecular weight of 552.98 g/mol. Its IUPAC name is benzhydryl 3-(chloromethyl)-7-[[2-(difluoromethylsulfanyl)acetyl]amino]-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl 3-(chloromethyl)-7-[[2-(difluoromethylsulfanyl)acetyl]amino]-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 13364173 |
| Molecular Formula | C25H23ClF2N2O6S |
| Molecular Weight | 552.98 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | benzhydryl 3-(chloromethyl)-7-[[2-(difluoromethylsulfanyl)acetyl]amino]-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC1(NC(=O)CSC(F)F)C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CCl)COC21 |
| InChI | InChI=1S/C25H23ClF2N2O6S/c1-34-25(29-18(31)14-37-24(27)28)22(33)30-19(17(12-26)13-35-23(25)30)21(32)36-20(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,20,23-24H,12-14H2,1H3,(H,29,31) |
| InChIKey | PIGCIWSUMLLPNV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.98 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|