About 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol
6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol (PubChem CID 13365156) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol.
Molecular Properties
| Compound Name | 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol |
| PubChem CID | 13365156 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol |
| SMILES | CN1Cc2occc2C(O)C1 |
| InChI | InChI=1S/C8H11NO2/c1-9-4-7(10)6-2-3-11-8(6)5-9/h2-3,7,10H,4-5H2,1H3 |
| InChIKey | NUWLTDVTUKIOEG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol?
The IUPAC name of 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol (CID 13365156) is 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol.
What is the SMILES notation for 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol?
The canonical SMILES for 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol is CN1Cc2occc2C(O)C1.
What is the InChIKey of 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol?
The InChIKey is NUWLTDVTUKIOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-9-4-7(10)6-2-3-11-8(6)5-9/h2-3,7,10H,4-5H2,1H3.
What are the key properties of 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol?
6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol has a molecular weight of 153.18 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-ol is sourced from PubChem (CID 13365156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).