About 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate
2,3-di(undec-10-enoyloxy)propyl undec-10-enoate (PubChem CID 13365716) has the molecular formula C36H62O6
and a molecular weight of 590.89 g/mol. Its IUPAC name is 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate.
Molecular Properties
| Compound Name | 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate |
| PubChem CID | 13365716 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC=C)OC(=O)CCCCCCCCC=C |
| InChI | InChI=1S/C36H62O6/c1-4-7-10-13-16-19-22-25-28-34(37)40-31-33(42-36(39)30-27-24-21-18-15-12-9-6-3)32-41-35(38)29-26-23-20-17-14-11-8-5-2/h4-6,33H,1-3,7-32H2 |
| InChIKey | LQAWJXRQRYWNFI-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate?
The IUPAC name of 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate (CID 13365716) is 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate.
What is the SMILES notation for 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate?
The canonical SMILES for 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate is C=CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC=C)OC(=O)CCCCCCCCC=C.
What is the InChIKey of 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate?
The InChIKey is LQAWJXRQRYWNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H62O6/c1-4-7-10-13-16-19-22-25-28-34(37)40-31-33(42-36(39)30-27-24-21-18-15-12-9-6-3)32-41-35(38)29-26-23-20-17-14-11-8-5-2/h4-6,33H,1-3,7-32H2.
What are the key properties of 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate?
2,3-di(undec-10-enoyloxy)propyl undec-10-enoate has a molecular weight of 590.89 g/mol, XLogP of 9.90, 32 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(undec-10-enoyloxy)propyl undec-10-enoate is sourced from PubChem (CID 13365716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).