C11H18N2S2 — CID 13365927
1-[2-(2-propyl-1,3-dithiolan-2-yl)ethyl]imidazole (PubChem CID 13365927) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-[2-(2-propyl-1,3-dithiolan-2-yl)ethyl]imidazole.
| Compound Name | 1-[2-(2-propyl-1,3-dithiolan-2-yl)ethyl]imidazole |
|---|---|
| PubChem CID | 13365927 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-[2-(2-propyl-1,3-dithiolan-2-yl)ethyl]imidazole |
| SMILES | CCCC1(CCn2ccnc2)SCCS1 |
| InChI | InChI=1S/C11H18N2S2/c1-2-3-11(14-8-9-15-11)4-6-13-7-5-12-10-13/h5,7,10H,2-4,6,8-9H2,1H3 |
| InChIKey | AQKCJULPHPKGNF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |