About 4-ethyl-1H-pyrazine-2,3-dione
4-ethyl-1H-pyrazine-2,3-dione (PubChem CID 13366245) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 4-ethyl-1H-pyrazine-2,3-dione.
Molecular Properties
| Compound Name | 4-ethyl-1H-pyrazine-2,3-dione |
| PubChem CID | 13366245 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 4-ethyl-1H-pyrazine-2,3-dione |
| SMILES | CCn1cc[nH]c(=O)c1=O |
| InChI | InChI=1S/C6H8N2O2/c1-2-8-4-3-7-5(9)6(8)10/h3-4H,2H2,1H3,(H,7,9) |
| InChIKey | WVLHVMZHVUCJGN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-1H-pyrazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1H-pyrazine-2,3-dione?
The IUPAC name of 4-ethyl-1H-pyrazine-2,3-dione (CID 13366245) is 4-ethyl-1H-pyrazine-2,3-dione.
What is the SMILES notation for 4-ethyl-1H-pyrazine-2,3-dione?
The canonical SMILES for 4-ethyl-1H-pyrazine-2,3-dione is CCn1cc[nH]c(=O)c1=O.
What is the InChIKey of 4-ethyl-1H-pyrazine-2,3-dione?
The InChIKey is WVLHVMZHVUCJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-2-8-4-3-7-5(9)6(8)10/h3-4H,2H2,1H3,(H,7,9).
What are the key properties of 4-ethyl-1H-pyrazine-2,3-dione?
4-ethyl-1H-pyrazine-2,3-dione has a molecular weight of 140.14 g/mol, XLogP of -0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1H-pyrazine-2,3-dione is sourced from PubChem (CID 13366245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).