About N'-(2,2-diethoxyethyl)-N-ethyloxamide
N'-(2,2-diethoxyethyl)-N-ethyloxamide (PubChem CID 13366331) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is N'-(2,2-diethoxyethyl)-N-ethyloxamide.
Molecular Properties
| Compound Name | N'-(2,2-diethoxyethyl)-N-ethyloxamide |
| PubChem CID | 13366331 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N'-(2,2-diethoxyethyl)-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)NCC(OCC)OCC |
| InChI | InChI=1S/C10H20N2O4/c1-4-11-9(13)10(14)12-7-8(15-5-2)16-6-3/h8H,4-7H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | BBATWGVQWXQZLD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2-diethoxyethyl)-N-ethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-diethoxyethyl)-N-ethyloxamide?
The IUPAC name of N'-(2,2-diethoxyethyl)-N-ethyloxamide (CID 13366331) is N'-(2,2-diethoxyethyl)-N-ethyloxamide.
What is the SMILES notation for N'-(2,2-diethoxyethyl)-N-ethyloxamide?
The canonical SMILES for N'-(2,2-diethoxyethyl)-N-ethyloxamide is CCNC(=O)C(=O)NCC(OCC)OCC.
What is the InChIKey of N'-(2,2-diethoxyethyl)-N-ethyloxamide?
The InChIKey is BBATWGVQWXQZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4/c1-4-11-9(13)10(14)12-7-8(15-5-2)16-6-3/h8H,4-7H2,1-3H3,(H,11,13)(H,12,14).
What are the key properties of N'-(2,2-diethoxyethyl)-N-ethyloxamide?
N'-(2,2-diethoxyethyl)-N-ethyloxamide has a molecular weight of 232.28 g/mol, XLogP of -0.36, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-diethoxyethyl)-N-ethyloxamide is sourced from PubChem (CID 13366331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).