About dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate
dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 1336647) has the molecular formula C18H18ClNO6
and a molecular weight of 379.80 g/mol. Its IUPAC name is dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 1336647 |
| Molecular Formula | C18H18ClNO6 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCN1C=C(C(=O)OC)C(c2cc3c(cc2Cl)OCO3)C(C(=O)OC)=C1 |
| InChI | InChI=1S/C18H18ClNO6/c1-4-20-7-11(17(21)23-2)16(12(8-20)18(22)24-3)10-5-14-15(6-13(10)19)26-9-25-14/h5-8,16H,4,9H2,1-3H3 |
| InChIKey | MFUUCXXGXNZRGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate (CID 1336647) is dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate is CCN1C=C(C(=O)OC)C(c2cc3c(cc2Cl)OCO3)C(C(=O)OC)=C1.
What is the InChIKey of dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate?
The InChIKey is MFUUCXXGXNZRGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO6/c1-4-20-7-11(17(21)23-2)16(12(8-20)18(22)24-3)10-5-14-15(6-13(10)19)26-9-25-14/h5-8,16H,4,9H2,1-3H3.
What are the key properties of dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate?
dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate has a molecular weight of 379.80 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-(6-chloro-1,3-benzodioxol-5-yl)-1-ethyl-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 1336647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).