C9H6N6O3 — CID 13370474
8-nitro-5,10-dihydrotetrazolo[5,1-c][1,4]benzodiazepin-4-one (PubChem CID 13370474) has the molecular formula C9H6N6O3 and a molecular weight of 246.19 g/mol. Its IUPAC name is 8-nitro-5,10-dihydrotetrazolo[5,1-c][1,4]benzodiazepin-4-one.
| Compound Name | 8-nitro-5,10-dihydrotetrazolo[5,1-c][1,4]benzodiazepin-4-one |
|---|---|
| PubChem CID | 13370474 |
| Molecular Formula | C9H6N6O3 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 8-nitro-5,10-dihydrotetrazolo[5,1-c][1,4]benzodiazepin-4-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2Cn2nnnc21 |
| InChI | InChI=1S/C9H6N6O3/c16-9-8-11-12-13-14(8)4-5-3-6(15(17)18)1-2-7(5)10-9/h1-3H,4H2,(H,10,16) |
| InChIKey | KUAMVYSSOQHIBC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|