About 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride
7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride (PubChem CID 13370643) has the molecular formula C29H30ClNO4
and a molecular weight of 492.02 g/mol. Its IUPAC name is 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride.
Molecular Properties
| Compound Name | 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride |
| PubChem CID | 13370643 |
| Molecular Formula | C29H30ClNO4 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride |
| SMILES | Cl.O=c1c(-c2ccccc2)c(-c2ccccc2)oc2cc(OCC(O)CNC3CCCC3)ccc12 |
| InChI | InChI=1S/C29H29NO4.ClH/c31-23(18-30-22-13-7-8-14-22)19-33-24-15-16-25-26(17-24)34-29(21-11-5-2-6-12-21)27(28(25)32)20-9-3-1-4-10-20;/h1-6,9-12,15-17,22-23,30-31H,7-8,13-14,18-19H2;1H |
| InChIKey | MWVMPYQZCVCBIL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride?
The IUPAC name of 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride (CID 13370643) is 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride.
What is the SMILES notation for 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride?
The canonical SMILES for 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride is Cl.O=c1c(-c2ccccc2)c(-c2ccccc2)oc2cc(OCC(O)CNC3CCCC3)ccc12.
What is the InChIKey of 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride?
The InChIKey is MWVMPYQZCVCBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29NO4.ClH/c31-23(18-30-22-13-7-8-14-22)19-33-24-15-16-25-26(17-24)34-29(21-11-5-2-6-12-21)27(28(25)32)20-9-3-1-4-10-20;/h1-6,9-12,15-17,22-23,30-31H,7-8,13-14,18-19H2;1H.
What are the key properties of 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride?
7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride has a molecular weight of 492.02 g/mol, XLogP of 5.82, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(cyclopentylamino)-2-hydroxypropoxy]-2,3-diphenylchromen-4-one;hydrochloride is sourced from PubChem (CID 13370643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).