About methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate
methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate (PubChem CID 13371025) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate.
Analyze methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate (CID 13371025) is methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate is COCc1cc(C(=O)OC)no1.
What is the InChIKey of methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate?
The InChIKey is PBGCIXARQZOKHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-10-4-5-3-6(8-12-5)7(9)11-2/h3H,4H2,1-2H3.
What are the key properties of methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate?
methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate has a molecular weight of 171.15 g/mol, XLogP of 0.61, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(methoxymethyl)-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 13371025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).