C16H22ClN3OS — CID 13371095
5-chloro-N-(8-imidazol-1-yloctyl)thiophene-2-carboxamide (PubChem CID 13371095) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is 5-chloro-N-(8-imidazol-1-yloctyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(8-imidazol-1-yloctyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 13371095 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-chloro-N-(8-imidazol-1-yloctyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCCCCCCCn1ccnc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H22ClN3OS/c17-15-8-7-14(22-15)16(21)19-9-5-3-1-2-4-6-11-20-12-10-18-13-20/h7-8,10,12-13H,1-6,9,11H2,(H,19,21) |
| InChIKey | IOIXXOZNWDTART-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|