C17H25N3O — CID 13371236
2,2-dimethyl-7-phenyl-4-(1,2,4-triazol-1-yl)heptan-3-ol (PubChem CID 13371236) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2,2-dimethyl-7-phenyl-4-(1,2,4-triazol-1-yl)heptan-3-ol.
| Compound Name | 2,2-dimethyl-7-phenyl-4-(1,2,4-triazol-1-yl)heptan-3-ol |
|---|---|
| PubChem CID | 13371236 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2,2-dimethyl-7-phenyl-4-(1,2,4-triazol-1-yl)heptan-3-ol |
| SMILES | CC(C)(C)C(O)C(CCCc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C17H25N3O/c1-17(2,3)16(21)15(20-13-18-12-19-20)11-7-10-14-8-5-4-6-9-14/h4-6,8-9,12-13,15-16,21H,7,10-11H2,1-3H3 |
| InChIKey | LNSLPSIYXGEBNX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |