C18H21FO — CID 13371413
(8R,9S,13S,14S)-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 13371413) has the molecular formula C18H21FO and a molecular weight of 272.36 g/mol. Its IUPAC name is (8R,9S,13S,14S)-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 13371413 |
| Molecular Formula | C18H21FO |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (8R,9S,13S,14S)-4-fluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cccc(F)c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H21FO/c1-18-10-9-12-11-3-2-4-16(19)14(11)6-5-13(12)15(18)7-8-17(18)20/h2-4,12-13,15H,5-10H2,1H3/t12-,13-,15+,18+/m1/s1 |
| InChIKey | IAYLIYRIEGBMCV-ONUSSAAZSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |