About 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole
3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole (PubChem CID 13371714) has the molecular formula C8H5N3S
and a molecular weight of 175.22 g/mol. Its IUPAC name is 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole.
Molecular Properties
| Compound Name | 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole |
| PubChem CID | 13371714 |
| Molecular Formula | C8H5N3S |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole |
| SMILES | c1cc2ccc3[nH]snc3c2n1 |
| InChI | InChI=1S/C8H5N3S/c1-2-6-8(11-12-10-6)7-5(1)3-4-9-7/h1-4,10H |
| InChIKey | HBLCJYSWQYWRKW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole?
The IUPAC name of 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole (CID 13371714) is 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole.
What is the SMILES notation for 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole?
The canonical SMILES for 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole is c1cc2ccc3[nH]snc3c2n1.
What is the InChIKey of 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole?
The InChIKey is HBLCJYSWQYWRKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S/c1-2-6-8(11-12-10-6)7-5(1)3-4-9-7/h1-4,10H.
What are the key properties of 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole?
3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole has a molecular weight of 175.22 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrolo[2,3-e][2,1,3]benzothiadiazole is sourced from PubChem (CID 13371714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).