About azane;1,2-dihydropyridazine-3,6-dione
azane;1,2-dihydropyridazine-3,6-dione (PubChem CID 13371891) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is azane;1,2-dihydropyridazine-3,6-dione.
Molecular Properties
| Compound Name | azane;1,2-dihydropyridazine-3,6-dione |
| PubChem CID | 13371891 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | azane;1,2-dihydropyridazine-3,6-dione |
| SMILES | N.O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H4N2O2.H3N/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);1H3 |
| InChIKey | LCUNINZNPMYVOC-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;1,2-dihydropyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-dihydropyridazine-3,6-dione?
The IUPAC name of azane;1,2-dihydropyridazine-3,6-dione (CID 13371891) is azane;1,2-dihydropyridazine-3,6-dione.
What is the SMILES notation for azane;1,2-dihydropyridazine-3,6-dione?
The canonical SMILES for azane;1,2-dihydropyridazine-3,6-dione is N.O=c1ccc(=O)[nH][nH]1.
What is the InChIKey of azane;1,2-dihydropyridazine-3,6-dione?
The InChIKey is LCUNINZNPMYVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.H3N/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);1H3.
What are the key properties of azane;1,2-dihydropyridazine-3,6-dione?
azane;1,2-dihydropyridazine-3,6-dione has a molecular weight of 129.12 g/mol, XLogP of -0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-dihydropyridazine-3,6-dione is sourced from PubChem (CID 13371891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).