C16H13Cl2FN2O — CID 13373356
3-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-4,5,6,7-tetrahydroindazole (PubChem CID 13373356) has the molecular formula C16H13Cl2FN2O and a molecular weight of 339.20 g/mol. Its IUPAC name is 3-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 13373356 |
| Molecular Formula | C16H13Cl2FN2O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-4,5,6,7-tetrahydroindazole |
| SMILES | C#CCOc1cc(-n2nc3c(c2Cl)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O/c1-2-7-22-15-9-14(12(19)8-11(15)17)21-16(18)10-5-3-4-6-13(10)20-21/h1,8-9H,3-7H2 |
| InChIKey | SKHORAKBOXLMHT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|