C13H10BrN5 — CID 13373715
6-(3-bromonaphthalen-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 13373715) has the molecular formula C13H10BrN5 and a molecular weight of 316.16 g/mol. Its IUPAC name is 6-(3-bromonaphthalen-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-bromonaphthalen-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 13373715 |
| Molecular Formula | C13H10BrN5 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 6-(3-bromonaphthalen-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2cc3ccccc3cc2Br)n1 |
| InChI | InChI=1S/C13H10BrN5/c14-10-6-8-4-2-1-3-7(8)5-9(10)11-17-12(15)19-13(16)18-11/h1-6H,(H4,15,16,17,18,19) |
| InChIKey | RXSSKAZHCZWJPP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |