About 1,1-dioxo-5-phenyl-1,2-thiazol-3-one
1,1-dioxo-5-phenyl-1,2-thiazol-3-one (PubChem CID 13373975) has the molecular formula C9H7NO3S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 1,1-dioxo-5-phenyl-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 1,1-dioxo-5-phenyl-1,2-thiazol-3-one |
| PubChem CID | 13373975 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 1,1-dioxo-5-phenyl-1,2-thiazol-3-one |
| SMILES | O=C1C=C(c2ccccc2)S(=O)(=O)N1 |
| InChI | InChI=1S/C9H7NO3S/c11-9-6-8(14(12,13)10-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
| InChIKey | XRTSKRBKMFJBJV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-5-phenyl-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-5-phenyl-1,2-thiazol-3-one?
The IUPAC name of 1,1-dioxo-5-phenyl-1,2-thiazol-3-one (CID 13373975) is 1,1-dioxo-5-phenyl-1,2-thiazol-3-one.
What is the SMILES notation for 1,1-dioxo-5-phenyl-1,2-thiazol-3-one?
The canonical SMILES for 1,1-dioxo-5-phenyl-1,2-thiazol-3-one is O=C1C=C(c2ccccc2)S(=O)(=O)N1.
What is the InChIKey of 1,1-dioxo-5-phenyl-1,2-thiazol-3-one?
The InChIKey is XRTSKRBKMFJBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S/c11-9-6-8(14(12,13)10-9)7-4-2-1-3-5-7/h1-6H,(H,10,11).
What are the key properties of 1,1-dioxo-5-phenyl-1,2-thiazol-3-one?
1,1-dioxo-5-phenyl-1,2-thiazol-3-one has a molecular weight of 209.23 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-5-phenyl-1,2-thiazol-3-one is sourced from PubChem (CID 13373975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).