C17H17NO — CID 13374326
N-methoxy-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine (PubChem CID 13374326) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is N-methoxy-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine.
| Compound Name | N-methoxy-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine |
|---|---|
| PubChem CID | 13374326 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-methoxy-2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine |
| SMILES | CONC1(C)c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C17H17NO/c1-17(18-19-2)15-9-5-3-7-13(15)11-12-14-8-4-6-10-16(14)17/h3-12,18H,1-2H3 |
| InChIKey | PGECQHZQBPMLIB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|