About 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate
2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate (PubChem CID 13374593) has the molecular formula C6H12N2O3S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate.
Molecular Properties
| Compound Name | 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate |
| PubChem CID | 13374593 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCSC(=O)NC |
| InChI | InChI=1S/C6H12N2O3S/c1-7-5(9)11-3-4-12-6(10)8-2/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| InChIKey | XPOVIOWMHFQZAO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate?
The IUPAC name of 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate (CID 13374593) is 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate.
What is the SMILES notation for 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate?
The canonical SMILES for 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate is CNC(=O)OCCSC(=O)NC.
What is the InChIKey of 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate?
The InChIKey is XPOVIOWMHFQZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3S/c1-7-5(9)11-3-4-12-6(10)8-2/h3-4H2,1-2H3,(H,7,9)(H,8,10).
What are the key properties of 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate?
2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate has a molecular weight of 192.24 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylcarbamoylsulfanyl)ethyl N-methylcarbamate is sourced from PubChem (CID 13374593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).