C19H22ClNO2 — CID 13375280
2-(anthracen-9-ylmethylamino)-2-methylpropane-1,3-diol;hydrochloride (PubChem CID 13375280) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 2-(anthracen-9-ylmethylamino)-2-methylpropane-1,3-diol;hydrochloride.
| Compound Name | 2-(anthracen-9-ylmethylamino)-2-methylpropane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 13375280 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(anthracen-9-ylmethylamino)-2-methylpropane-1,3-diol;hydrochloride |
| SMILES | CC(CO)(CO)NCc1c2ccccc2cc2ccccc12.Cl |
| InChI | InChI=1S/C19H21NO2.ClH/c1-19(12-21,13-22)20-11-18-16-8-4-2-6-14(16)10-15-7-3-5-9-17(15)18;/h2-10,20-22H,11-13H2,1H3;1H |
| InChIKey | PCYIZVAFAVVYGL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|