About methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol
methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol (PubChem CID 13375286) has the molecular formula C21H27NO5S2
and a molecular weight of 437.58 g/mol. Its IUPAC name is methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol.
Molecular Properties
| Compound Name | methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol |
| PubChem CID | 13375286 |
| Molecular Formula | C21H27NO5S2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol |
| SMILES | CS(=O)(=O)O.CSc1c2ccccc2c(CNC(C)(CO)CO)c2ccccc12 |
| InChI | InChI=1S/C20H23NO2S.CH4O3S/c1-20(12-22,13-23)21-11-18-14-7-3-5-9-16(14)19(24-2)17-10-6-4-8-15(17)18;1-5(2,3)4/h3-10,21-23H,11-13H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | LQKJGQDFJHDEKW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol?
The IUPAC name of methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol (CID 13375286) is methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol.
What is the SMILES notation for methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol?
The canonical SMILES for methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol is CS(=O)(=O)O.CSc1c2ccccc2c(CNC(C)(CO)CO)c2ccccc12.
What is the InChIKey of methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol?
The InChIKey is LQKJGQDFJHDEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2S.CH4O3S/c1-20(12-22,13-23)21-11-18-14-7-3-5-9-16(14)19(24-2)17-10-6-4-8-15(17)18;1-5(2,3)4/h3-10,21-23H,11-13H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol?
methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol has a molecular weight of 437.58 g/mol, XLogP of 3.05, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol is sourced from PubChem (CID 13375286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).