C20H23NO2 — CID 13375294
2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol (PubChem CID 13375294) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 13375294 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol |
| SMILES | Cc1c2ccccc2c(CNC(C)(CO)CO)c2ccccc12 |
| InChI | InChI=1S/C20H23NO2/c1-14-15-7-3-5-9-17(15)19(11-21-20(2,12-22)13-23)18-10-6-4-8-16(14)18/h3-10,21-23H,11-13H2,1-2H3 |
| InChIKey | SKKLYHCODMXQEG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|