C20H23Cl2NO5S — CID 13375302
2-[(4,5-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid (PubChem CID 13375302) has the molecular formula C20H23Cl2NO5S and a molecular weight of 460.38 g/mol. Its IUPAC name is 2-[(4,5-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid.
| Compound Name | 2-[(4,5-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid |
|---|---|
| PubChem CID | 13375302 |
| Molecular Formula | C20H23Cl2NO5S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-[(4,5-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol;methanesulfonic acid |
| SMILES | CC(CO)(CO)NCc1c2cccc(Cl)c2cc2c(Cl)cccc12.CS(=O)(=O)O |
| InChI | InChI=1S/C19H19Cl2NO2.CH4O3S/c1-19(10-23,11-24)22-9-16-12-4-2-6-17(20)14(12)8-15-13(16)5-3-7-18(15)21;1-5(2,3)4/h2-8,22-24H,9-11H2,1H3;1H3,(H,2,3,4) |
| InChIKey | ABTGDDSERFHYNC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|