C21H26ClNO3 — CID 13375327
2-(anthracen-9-ylmethylamino)-2-(ethoxymethyl)propane-1,3-diol;hydrochloride (PubChem CID 13375327) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-(anthracen-9-ylmethylamino)-2-(ethoxymethyl)propane-1,3-diol;hydrochloride.
| Compound Name | 2-(anthracen-9-ylmethylamino)-2-(ethoxymethyl)propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 13375327 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(anthracen-9-ylmethylamino)-2-(ethoxymethyl)propane-1,3-diol;hydrochloride |
| SMILES | CCOCC(CO)(CO)NCc1c2ccccc2cc2ccccc12.Cl |
| InChI | InChI=1S/C21H25NO3.ClH/c1-2-25-15-21(13-23,14-24)22-12-20-18-9-5-3-7-16(18)11-17-8-4-6-10-19(17)20;/h3-11,22-24H,2,12-15H2,1H3;1H |
| InChIKey | BZDHLRHBILCATF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|