About cis-(1S,3R)-2-aminocyclohexane-1,3-diol
cis-(1S,3R)-2-aminocyclohexane-1,3-diol (PubChem CID 13375420) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is cis-(1S,3R)-2-aminocyclohexane-1,3-diol.
Molecular Properties
| Compound Name | cis-(1S,3R)-2-aminocyclohexane-1,3-diol |
| PubChem CID | 13375420 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | cis-(1S,3R)-2-aminocyclohexane-1,3-diol |
| SMILES | NC1[C@H](O)CCC[C@@H]1O |
| InChI | InChI=1S/C6H13NO2/c7-6-4(8)2-1-3-5(6)9/h4-6,8-9H,1-3,7H2/t4-,5+,6? |
| InChIKey | MNLZNJPXUJURMD-XEAPYIEGSA-N |
| XLogP | -0.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,3R)-2-aminocyclohexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-2-aminocyclohexane-1,3-diol?
The IUPAC name of cis-(1S,3R)-2-aminocyclohexane-1,3-diol (CID 13375420) is cis-(1S,3R)-2-aminocyclohexane-1,3-diol.
What is the SMILES notation for cis-(1S,3R)-2-aminocyclohexane-1,3-diol?
The canonical SMILES for cis-(1S,3R)-2-aminocyclohexane-1,3-diol is NC1[C@H](O)CCC[C@@H]1O.
What is the InChIKey of cis-(1S,3R)-2-aminocyclohexane-1,3-diol?
The InChIKey is MNLZNJPXUJURMD-XEAPYIEGSA-N. The full InChI is InChI=1S/C6H13NO2/c7-6-4(8)2-1-3-5(6)9/h4-6,8-9H,1-3,7H2/t4-,5+,6?.
What are the key properties of cis-(1S,3R)-2-aminocyclohexane-1,3-diol?
cis-(1S,3R)-2-aminocyclohexane-1,3-diol has a molecular weight of 131.17 g/mol, XLogP of -0.78, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-2-aminocyclohexane-1,3-diol is sourced from PubChem (CID 13375420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).