C21H21ClN2OS2 — CID 13375551
(4-chlorophenyl)methyl (3R)-3-(2-hydroxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate (PubChem CID 13375551) has the molecular formula C21H21ClN2OS2 and a molecular weight of 417.00 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (3R)-3-(2-hydroxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate.
| Compound Name | (4-chlorophenyl)methyl (3R)-3-(2-hydroxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
|---|---|
| PubChem CID | 13375551 |
| Molecular Formula | C21H21ClN2OS2 |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (4-chlorophenyl)methyl (3R)-3-(2-hydroxyethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
| SMILES | OCC[C@H]1Cc2c([nH]c3ccccc23)CN1C(=S)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2OS2/c22-15-7-5-14(6-8-15)13-27-21(26)24-12-20-18(11-16(24)9-10-25)17-3-1-2-4-19(17)23-20/h1-8,16,23,25H,9-13H2/t16-/m0/s1 |
| InChIKey | GTLMOMUKDKVDEJ-INIZCTEOSA-N |
| XLogP | 5.15 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|