C16H25N7O — CID 13377446
N-[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]acetamide (PubChem CID 13377446) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 13377446 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | N-[1-[4,6-bis(prop-2-enylamino)-1,3,5-triazin-2-yl]piperidin-4-yl]acetamide |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NC(C)=O)CC2)n1 |
| InChI | InChI=1S/C16H25N7O/c1-4-8-17-14-20-15(18-9-5-2)22-16(21-14)23-10-6-13(7-11-23)19-12(3)24/h4-5,13H,1-2,6-11H2,3H3,(H,19,24)(H2,17,18,20,21,22) |
| InChIKey | DNZOZZCCZWDRHX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|