About 2-[2,6-di(propan-2-yl)anilino]ethanol
2-[2,6-di(propan-2-yl)anilino]ethanol (PubChem CID 13378299) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)anilino]ethanol.
Molecular Properties
| Compound Name | 2-[2,6-di(propan-2-yl)anilino]ethanol |
| PubChem CID | 13378299 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)anilino]ethanol |
| SMILES | CC(C)c1cccc(C(C)C)c1NCCO |
| InChI | InChI=1S/C14H23NO/c1-10(2)12-6-5-7-13(11(3)4)14(12)15-8-9-16/h5-7,10-11,15-16H,8-9H2,1-4H3 |
| InChIKey | UMAZPYIDZHFJSU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2,6-di(propan-2-yl)anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-di(propan-2-yl)anilino]ethanol?
The IUPAC name of 2-[2,6-di(propan-2-yl)anilino]ethanol (CID 13378299) is 2-[2,6-di(propan-2-yl)anilino]ethanol.
What is the SMILES notation for 2-[2,6-di(propan-2-yl)anilino]ethanol?
The canonical SMILES for 2-[2,6-di(propan-2-yl)anilino]ethanol is CC(C)c1cccc(C(C)C)c1NCCO.
What is the InChIKey of 2-[2,6-di(propan-2-yl)anilino]ethanol?
The InChIKey is UMAZPYIDZHFJSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-10(2)12-6-5-7-13(11(3)4)14(12)15-8-9-16/h5-7,10-11,15-16H,8-9H2,1-4H3.
What are the key properties of 2-[2,6-di(propan-2-yl)anilino]ethanol?
2-[2,6-di(propan-2-yl)anilino]ethanol has a molecular weight of 221.34 g/mol, XLogP of 3.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-di(propan-2-yl)anilino]ethanol is sourced from PubChem (CID 13378299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).