About 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile
2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile (PubChem CID 13379964) has the molecular formula C6H8ClN
and a molecular weight of 129.59 g/mol. Its IUPAC name is 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile.
Molecular Properties
| Compound Name | 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile |
| PubChem CID | 13379964 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile |
| SMILES | C[C@@H]1C[C@H]1C(Cl)C#N |
| InChI | InChI=1S/C6H8ClN/c1-4-2-5(4)6(7)3-8/h4-6H,2H2,1H3/t4-,5-,6?/m1/s1 |
| InChIKey | UKWPTJJLVUYSTE-QYRBDRAASA-N |
| XLogP | 1.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile?
The IUPAC name of 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile (CID 13379964) is 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile.
What is the SMILES notation for 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile?
The canonical SMILES for 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile is C[C@@H]1C[C@H]1C(Cl)C#N.
What is the InChIKey of 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile?
The InChIKey is UKWPTJJLVUYSTE-QYRBDRAASA-N. The full InChI is InChI=1S/C6H8ClN/c1-4-2-5(4)6(7)3-8/h4-6H,2H2,1H3/t4-,5-,6?/m1/s1.
What are the key properties of 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile?
2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile has a molecular weight of 129.59 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-[(1R,2R)-2-methylcyclopropyl]acetonitrile is sourced from PubChem (CID 13379964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).