C13H17N — CID 13380222
2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine (PubChem CID 13380222) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine.
| Compound Name | 2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine |
|---|---|
| PubChem CID | 13380222 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine |
| SMILES | c1ccc2c(c1)CCC1CCCCN21 |
| InChI | InChI=1S/C13H17N/c1-2-7-13-11(5-1)8-9-12-6-3-4-10-14(12)13/h1-2,5,7,12H,3-4,6,8-10H2 |
| InChIKey | BBDSHWCHKVXFOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |