About N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide
N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 1338052) has the molecular formula C20H15N3O2S2
and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| PubChem CID | 1338052 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc2oc(-c3cccc(NC(=S)NC(=O)c4cccs4)c3)nc2c1 |
| InChI | InChI=1S/C20H15N3O2S2/c1-12-7-8-16-15(10-12)22-19(25-16)13-4-2-5-14(11-13)21-20(26)23-18(24)17-6-3-9-27-17/h2-11H,1H3,(H2,21,23,24,26) |
| InChIKey | WAGOIPZKCCKUBO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide?
The IUPAC name of N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide (CID 1338052) is N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide?
The canonical SMILES for N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide is Cc1ccc2oc(-c3cccc(NC(=S)NC(=O)c4cccs4)c3)nc2c1.
What is the InChIKey of N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide?
The InChIKey is WAGOIPZKCCKUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2S2/c1-12-7-8-16-15(10-12)22-19(25-16)13-4-2-5-14(11-13)21-20(26)23-18(24)17-6-3-9-27-17/h2-11H,1H3,(H2,21,23,24,26).
What are the key properties of N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide?
N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide has a molecular weight of 393.49 g/mol, XLogP of 4.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]thiophene-2-carboxamide is sourced from PubChem (CID 1338052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).