C28H26O12S4 — CID 13380534
[(2R,3S)-2,3,4-tris(benzenesulfonyloxy)butyl] benzenesulfonate (PubChem CID 13380534) has the molecular formula C28H26O12S4 and a molecular weight of 682.77 g/mol. Its IUPAC name is [(2R,3S)-2,3,4-tris(benzenesulfonyloxy)butyl] benzenesulfonate.
| Compound Name | [(2R,3S)-2,3,4-tris(benzenesulfonyloxy)butyl] benzenesulfonate |
|---|---|
| PubChem CID | 13380534 |
| Molecular Formula | C28H26O12S4 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.03 |
| IUPAC Name | [(2R,3S)-2,3,4-tris(benzenesulfonyloxy)butyl] benzenesulfonate |
| SMILES | O=S(=O)(OC[C@H](OS(=O)(=O)c1ccccc1)[C@@H](COS(=O)(=O)c1ccccc1)OS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26O12S4/c29-41(30,23-13-5-1-6-14-23)37-21-27(39-43(33,34)25-17-9-3-10-18-25)28(40-44(35,36)26-19-11-4-12-20-26)22-38-42(31,32)24-15-7-2-8-16-24/h1-20,27-28H,21-22H2/t27-,28+ |
| InChIKey | YOHCWTMJJCXYCI-HNRBIFIRSA-N |
| XLogP | 3.35 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|